C8H15F2N — CID 171493318
(E)-2-(1,1-difluoroethyl)but-2-en-1-imine;ethane (PubChem CID 171493318) has the molecular formula C8H15F2N and a molecular weight of 163.21 g/mol. Its IUPAC name is (E)-2-(1,1-difluoroethyl)but-2-en-1-imine;ethane.
| Compound Name | (E)-2-(1,1-difluoroethyl)but-2-en-1-imine;ethane |
|---|---|
| PubChem CID | 171493318 |
| Molecular Formula | C8H15F2N |
| Molecular Weight | 163.21 g/mol |
| Exact Mass | 163.12 |
| IUPAC Name | (E)-2-(1,1-difluoroethyl)but-2-en-1-imine;ethane |
| SMILES | CC.[H]/N=C/C(=C\C)C(C)(F)F |
| InChI | InChI=1S/C6H9F2N.C2H6/c1-3-5(4-9)6(2,7)8;1-2/h3-4,9H,1-2H3;1-2H3/b5-3+,9-4+; |
| InChIKey | VLUZLWUWTKVAKC-PVFOATAVSA-N |
| XLogP | 3.26 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.21 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|