C30H42F3N5O2 — CID 171493353
(1E,3Z,7Z)-4-methylcycloocta-1,3,7-triene-1-carbonitrile;3-[methyl-[3-oxo-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-7-yl]amino]-N-pentyl-N-propylpropanamide (PubChem CID 171493353) has the molecular formula C30H42F3N5O2 and a molecular weight of 561.69 g/mol. Its IUPAC name is (1E,3Z,7Z)-4-methylcycloocta-1,3,7-triene-1-carbonitrile;3-[methyl-[3-oxo-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-7-yl]amino]-N-pentyl-N-propylpropanamide.
| Compound Name | (1E,3Z,7Z)-4-methylcycloocta-1,3,7-triene-1-carbonitrile;3-[methyl-[3-oxo-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-7-yl]amino]-N-pentyl-N-propylpropanamide |
|---|---|
| PubChem CID | 171493353 |
| Molecular Formula | C30H42F3N5O2 |
| Molecular Weight | 561.69 g/mol |
| Exact Mass | 561.33 |
| IUPAC Name | (1E,3Z,7Z)-4-methylcycloocta-1,3,7-triene-1-carbonitrile;3-[methyl-[3-oxo-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-7-yl]amino]-N-pentyl-N-propylpropanamide |
| SMILES | C/C1=C/C=C(C#N)\C=C/CC1.CCCCCN(CCC)C(=O)CCN(C)C1CCc2c1n[nH]c(=O)c2C(F)(F)F |
| InChI | InChI=1S/C20H31F3N4O2.C10H11N/c1-4-6-7-12-27(11-5-2)16(28)10-13-26(3)15-9-8-14-17(20(21,22)23)19(29)25-24-18(14)15;1-9-4-2-3-5-10(8-11)7-6-9/h15H,4-13H2,1-3H3,(H,25,29);3,5-7H,2,4H2,1H3/b;5-3-,9-6-,10-7+ |
| InChIKey | ACCRJWAWPMSGFZ-TXDXIYKNSA-N |
| XLogP | 6.26 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.69 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|