C30H42F3N5O — CID 171493415
(2E,4E)-2-ethenyl-10-[4-[[3-oxo-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-7-yl]amino]but-1-en-2-yl-propylamino]-5-propyldeca-2,4-dienenitrile (PubChem CID 171493415) has the molecular formula C30H42F3N5O and a molecular weight of 545.69 g/mol. Its IUPAC name is (2E,4E)-2-ethenyl-10-[4-[[3-oxo-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-7-yl]amino]but-1-en-2-yl-propylamino]-5-propyldeca-2,4-dienenitrile.
| Compound Name | (2E,4E)-2-ethenyl-10-[4-[[3-oxo-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-7-yl]amino]but-1-en-2-yl-propylamino]-5-propyldeca-2,4-dienenitrile |
|---|---|
| PubChem CID | 171493415 |
| Molecular Formula | C30H42F3N5O |
| Molecular Weight | 545.69 g/mol |
| Exact Mass | 545.33 |
| IUPAC Name | (2E,4E)-2-ethenyl-10-[4-[[3-oxo-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-7-yl]amino]but-1-en-2-yl-propylamino]-5-propyldeca-2,4-dienenitrile |
| SMILES | C=C/C(C#N)=C\C=C(/CCC)CCCCCN(CCC)C(=C)CCNC1CCc2c1n[nH]c(=O)c2C(F)(F)F |
| InChI | InChI=1S/C30H42F3N5O/c1-5-11-24(14-13-23(7-3)21-34)12-9-8-10-20-38(19-6-2)22(4)17-18-35-26-16-15-25-27(30(31,32)33)29(39)37-36-28(25)26/h7,13-14,26,35H,3-6,8-12,15-20H2,1-2H3,(H,37,39)/b23-13+,24-14+ |
| InChIKey | JSINLIQROBIRGB-RNIAWFEPSA-N |
| XLogP | 6.90 |
| TPSA | 84.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.69 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|