C32H46F3N5O — CID 171493410
(2E,4E)-10-[4-[[6,6-dimethyl-3-oxo-4-(trifluoromethyl)-5,7-dihydro-2H-cyclopenta[c]pyridazin-7-yl]amino]but-1-en-2-yl-propylamino]-2-ethenyl-5-propyldeca-2,4-dienenitrile (PubChem CID 171493410) has the molecular formula C32H46F3N5O and a molecular weight of 573.75 g/mol. Its IUPAC name is (2E,4E)-10-[4-[[6,6-dimethyl-3-oxo-4-(trifluoromethyl)-5,7-dihydro-2H-cyclopenta[c]pyridazin-7-yl]amino]but-1-en-2-yl-propylamino]-2-ethenyl-5-propyldeca-2,4-dienenitrile.
| Compound Name | (2E,4E)-10-[4-[[6,6-dimethyl-3-oxo-4-(trifluoromethyl)-5,7-dihydro-2H-cyclopenta[c]pyridazin-7-yl]amino]but-1-en-2-yl-propylamino]-2-ethenyl-5-propyldeca-2,4-dienenitrile |
|---|---|
| PubChem CID | 171493410 |
| Molecular Formula | C32H46F3N5O |
| Molecular Weight | 573.75 g/mol |
| Exact Mass | 573.37 |
| IUPAC Name | (2E,4E)-10-[4-[[6,6-dimethyl-3-oxo-4-(trifluoromethyl)-5,7-dihydro-2H-cyclopenta[c]pyridazin-7-yl]amino]but-1-en-2-yl-propylamino]-2-ethenyl-5-propyldeca-2,4-dienenitrile |
| SMILES | C=C/C(C#N)=C\C=C(/CCC)CCCCCN(CCC)C(=C)CCNC1c2n[nH]c(=O)c(C(F)(F)F)c2CC1(C)C |
| InChI | InChI=1S/C32H46F3N5O/c1-7-13-25(16-15-24(9-3)22-36)14-11-10-12-20-40(19-8-2)23(4)17-18-37-29-28-26(21-31(29,5)6)27(32(33,34)35)30(41)39-38-28/h9,15-16,29,37H,3-4,7-8,10-14,17-21H2,1-2,5-6H3,(H,39,41)/b24-15+,25-16+ |
| InChIKey | BRVOVNKQBSPVNZ-FEZYOMQXSA-N |
| XLogP | 7.54 |
| TPSA | 84.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.75 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|