C28H40F4N4O3 — CID 171493373
2-cyclooctyloxy-N-[4-(1,1-difluoroethyl)-3-oxo-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-7-yl]acetamide;(E)-2-(1,1-difluoroethyl)-N-prop-1-en-2-ylbut-2-en-1-imine (PubChem CID 171493373) has the molecular formula C28H40F4N4O3 and a molecular weight of 556.65 g/mol. Its IUPAC name is 2-cyclooctyloxy-N-[4-(1,1-difluoroethyl)-3-oxo-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-7-yl]acetamide;(E)-2-(1,1-difluoroethyl)-N-prop-1-en-2-ylbut-2-en-1-imine.
| Compound Name | 2-cyclooctyloxy-N-[4-(1,1-difluoroethyl)-3-oxo-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-7-yl]acetamide;(E)-2-(1,1-difluoroethyl)-N-prop-1-en-2-ylbut-2-en-1-imine |
|---|---|
| PubChem CID | 171493373 |
| Molecular Formula | C28H40F4N4O3 |
| Molecular Weight | 556.65 g/mol |
| Exact Mass | 556.30 |
| IUPAC Name | 2-cyclooctyloxy-N-[4-(1,1-difluoroethyl)-3-oxo-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-7-yl]acetamide;(E)-2-(1,1-difluoroethyl)-N-prop-1-en-2-ylbut-2-en-1-imine |
| SMILES | C=C(C)/N=C/C(=C\C)C(C)(F)F.CC(F)(F)c1c2c(n[nH]c1=O)C(NC(=O)COC1CCCCCCC1)CC2 |
| InChI | InChI=1S/C19H27F2N3O3.C9H13F2N/c1-19(20,21)16-13-9-10-14(17(13)23-24-18(16)26)22-15(25)11-27-12-7-5-3-2-4-6-8-12;1-5-8(9(4,10)11)6-12-7(2)3/h12,14H,2-11H2,1H3,(H,22,25)(H,24,26);5-6H,2H2,1,3-4H3/b;8-5+,12-6+ |
| InChIKey | GIEBXIVTOAGAOY-BZVCZWPPSA-N |
| XLogP | 6.31 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.65 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|