C19H28F3N3O3 — CID 171492919
2-nonan-4-yloxy-N-[3-oxo-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-7-yl]acetamide (PubChem CID 171492919) has the molecular formula C19H28F3N3O3 and a molecular weight of 403.45 g/mol. Its IUPAC name is 2-nonan-4-yloxy-N-[3-oxo-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-7-yl]acetamide.
| Compound Name | 2-nonan-4-yloxy-N-[3-oxo-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-7-yl]acetamide |
|---|---|
| PubChem CID | 171492919 |
| Molecular Formula | C19H28F3N3O3 |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | 2-nonan-4-yloxy-N-[3-oxo-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-7-yl]acetamide |
| SMILES | CCCCCC(CCC)OCC(=O)NC1CCc2c1n[nH]c(=O)c2C(F)(F)F |
| InChI | InChI=1S/C19H28F3N3O3/c1-3-5-6-8-12(7-4-2)28-11-15(26)23-14-10-9-13-16(19(20,21)22)18(27)25-24-17(13)14/h12,14H,3-11H2,1-2H3,(H,23,26)(H,25,27) |
| InChIKey | GDPBLJXHOCSDEI-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|