C20H30F3N3O2 — CID 171493725
7-(3-nonan-4-yloxyprop-1-en-2-ylamino)-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one (PubChem CID 171493725) has the molecular formula C20H30F3N3O2 and a molecular weight of 401.47 g/mol. Its IUPAC name is 7-(3-nonan-4-yloxyprop-1-en-2-ylamino)-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one.
| Compound Name | 7-(3-nonan-4-yloxyprop-1-en-2-ylamino)-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one |
|---|---|
| PubChem CID | 171493725 |
| Molecular Formula | C20H30F3N3O2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | 7-(3-nonan-4-yloxyprop-1-en-2-ylamino)-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one |
| SMILES | C=C(COC(CCC)CCCCC)NC1CCc2c1n[nH]c(=O)c2C(F)(F)F |
| InChI | InChI=1S/C20H30F3N3O2/c1-4-6-7-9-14(8-5-2)28-12-13(3)24-16-11-10-15-17(20(21,22)23)19(27)26-25-18(15)16/h14,16,24H,3-12H2,1-2H3,(H,26,27) |
| InChIKey | MHULRZRNDCSDJH-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|