C21H14ClFN6O — CID 171494286
4-[3-[4-(chloromethyl)phenyl]-5-(5-fluoro-2-pyridinyl)imidazo[4,5-b]pyridin-2-yl]-1,2-oxazol-3-amine (PubChem CID 171494286) has the molecular formula C21H14ClFN6O and a molecular weight of 420.84 g/mol. Its IUPAC name is 4-[3-[4-(chloromethyl)phenyl]-5-(5-fluoro-2-pyridinyl)imidazo[4,5-b]pyridin-2-yl]-1,2-oxazol-3-amine.
| Compound Name | 4-[3-[4-(chloromethyl)phenyl]-5-(5-fluoro-2-pyridinyl)imidazo[4,5-b]pyridin-2-yl]-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 171494286 |
| Molecular Formula | C21H14ClFN6O |
| Molecular Weight | 420.84 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 4-[3-[4-(chloromethyl)phenyl]-5-(5-fluoro-2-pyridinyl)imidazo[4,5-b]pyridin-2-yl]-1,2-oxazol-3-amine |
| SMILES | Nc1nocc1-c1nc2ccc(-c3ccc(F)cn3)nc2n1-c1ccc(CCl)cc1 |
| InChI | InChI=1S/C21H14ClFN6O/c22-9-12-1-4-14(5-2-12)29-20(15-11-30-28-19(15)24)27-18-8-7-17(26-21(18)29)16-6-3-13(23)10-25-16/h1-8,10-11H,9H2,(H2,24,28) |
| InChIKey | FPLYUXSCXDJACY-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 95.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.84 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|