C15H13F2N3O5 — CID 171494348
[4-[[6-(difluoromethoxy)-3-nitro-2-pyridinyl]amino]phenyl]methyl acetate (PubChem CID 171494348) has the molecular formula C15H13F2N3O5 and a molecular weight of 353.28 g/mol. Its IUPAC name is [4-[[6-(difluoromethoxy)-3-nitro-2-pyridinyl]amino]phenyl]methyl acetate.
| Compound Name | [4-[[6-(difluoromethoxy)-3-nitro-2-pyridinyl]amino]phenyl]methyl acetate |
|---|---|
| PubChem CID | 171494348 |
| Molecular Formula | C15H13F2N3O5 |
| Molecular Weight | 353.28 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | [4-[[6-(difluoromethoxy)-3-nitro-2-pyridinyl]amino]phenyl]methyl acetate |
| SMILES | CC(=O)OCc1ccc(Nc2nc(OC(F)F)ccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H13F2N3O5/c1-9(21)24-8-10-2-4-11(5-3-10)18-14-12(20(22)23)6-7-13(19-14)25-15(16)17/h2-7,15H,8H2,1H3,(H,18,19) |
| InChIKey | IXPMQWUUFLXHTR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.28 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|