C13H11F2N3O4 — CID 171496139
[4-[[6-(difluoromethoxy)-3-nitro-2-pyridinyl]amino]phenyl]methanol (PubChem CID 171496139) has the molecular formula C13H11F2N3O4 and a molecular weight of 311.24 g/mol. Its IUPAC name is [4-[[6-(difluoromethoxy)-3-nitro-2-pyridinyl]amino]phenyl]methanol.
| Compound Name | [4-[[6-(difluoromethoxy)-3-nitro-2-pyridinyl]amino]phenyl]methanol |
|---|---|
| PubChem CID | 171496139 |
| Molecular Formula | C13H11F2N3O4 |
| Molecular Weight | 311.24 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | [4-[[6-(difluoromethoxy)-3-nitro-2-pyridinyl]amino]phenyl]methanol |
| SMILES | O=[N+]([O-])c1ccc(OC(F)F)nc1Nc1ccc(CO)cc1 |
| InChI | InChI=1S/C13H11F2N3O4/c14-13(15)22-11-6-5-10(18(20)21)12(17-11)16-9-3-1-8(7-19)2-4-9/h1-6,13,19H,7H2,(H,16,17) |
| InChIKey | LNJZWHMPLPUZRY-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 97.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.24 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|