C22H26N8 — CID 171496392
3-[5-[amino-[(Z)-2-aminoethenyl]amino]-3-(4-methylphenyl)imidazo[4,5-b]pyridin-2-yl]pyridin-2-amine;ethane (PubChem CID 171496392) has the molecular formula C22H26N8 and a molecular weight of 402.51 g/mol. Its IUPAC name is 3-[5-[amino-[(Z)-2-aminoethenyl]amino]-3-(4-methylphenyl)imidazo[4,5-b]pyridin-2-yl]pyridin-2-amine;ethane.
| Compound Name | 3-[5-[amino-[(Z)-2-aminoethenyl]amino]-3-(4-methylphenyl)imidazo[4,5-b]pyridin-2-yl]pyridin-2-amine;ethane |
|---|---|
| PubChem CID | 171496392 |
| Molecular Formula | C22H26N8 |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 3-[5-[amino-[(Z)-2-aminoethenyl]amino]-3-(4-methylphenyl)imidazo[4,5-b]pyridin-2-yl]pyridin-2-amine;ethane |
| SMILES | CC.Cc1ccc(-n2c(-c3cccnc3N)nc3ccc(N(N)/C=C\N)nc32)cc1 |
| InChI | InChI=1S/C20H20N8.C2H6/c1-13-4-6-14(7-5-13)28-19(15-3-2-11-24-18(15)22)25-16-8-9-17(26-20(16)28)27(23)12-10-21;1-2/h2-12H,21,23H2,1H3,(H2,22,24);1-2H3/b12-10-; |
| InChIKey | ACOYECMVAOPYNR-BBJSDXRSSA-N |
| XLogP | 3.51 |
| TPSA | 124.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|