C17H20N2O — CID 171496652
(3Z)-6-[3-(aminomethyl)-4-ethenyl-3,6-dihydro-2H-pyran-5-yl]-2,5-dimethylidenehepta-3,6-dienenitrile (PubChem CID 171496652) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is (3Z)-6-[3-(aminomethyl)-4-ethenyl-3,6-dihydro-2H-pyran-5-yl]-2,5-dimethylidenehepta-3,6-dienenitrile.
| Compound Name | (3Z)-6-[3-(aminomethyl)-4-ethenyl-3,6-dihydro-2H-pyran-5-yl]-2,5-dimethylidenehepta-3,6-dienenitrile |
|---|---|
| PubChem CID | 171496652 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | (3Z)-6-[3-(aminomethyl)-4-ethenyl-3,6-dihydro-2H-pyran-5-yl]-2,5-dimethylidenehepta-3,6-dienenitrile |
| SMILES | C=CC1=C(C(=C)C(=C)/C=C\C(=C)C#N)COCC1CN |
| InChI | InChI=1S/C17H20N2O/c1-5-16-15(9-19)10-20-11-17(16)14(4)13(3)7-6-12(2)8-18/h5-7,15H,1-4,9-11,19H2/b7-6- |
| InChIKey | CULVISTVBPGNHS-SREVYHEPSA-N |
| XLogP | 2.82 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|