C12H16ClN3O2 — CID 171497583
tert-butyl 2-[(4-amino-2-chloro-3-pyridinyl)methylideneamino]acetate (PubChem CID 171497583) has the molecular formula C12H16ClN3O2 and a molecular weight of 269.73 g/mol. Its IUPAC name is tert-butyl 2-[(4-amino-2-chloro-3-pyridinyl)methylideneamino]acetate.
| Compound Name | tert-butyl 2-[(4-amino-2-chloro-3-pyridinyl)methylideneamino]acetate |
|---|---|
| PubChem CID | 171497583 |
| Molecular Formula | C12H16ClN3O2 |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | tert-butyl 2-[(4-amino-2-chloro-3-pyridinyl)methylideneamino]acetate |
| SMILES | CC(C)(C)OC(=O)C/N=C/c1c(N)ccnc1Cl |
| InChI | InChI=1S/C12H16ClN3O2/c1-12(2,3)18-10(17)7-15-6-8-9(14)4-5-16-11(8)13/h4-6H,7H2,1-3H3,(H2,14,16)/b15-6+ |
| InChIKey | NWWXPKMMIXCQHE-GIDUJCDVSA-N |
| XLogP | 2.08 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|