C11H22N2O2S — CID 171500142
(5-formamido-2,2,4,4-tetramethylpentyl)carbamothioic S-acid (PubChem CID 171500142) has the molecular formula C11H22N2O2S and a molecular weight of 246.38 g/mol. Its IUPAC name is (5-formamido-2,2,4,4-tetramethylpentyl)carbamothioic S-acid.
| Compound Name | (5-formamido-2,2,4,4-tetramethylpentyl)carbamothioic S-acid |
|---|---|
| PubChem CID | 171500142 |
| Molecular Formula | C11H22N2O2S |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | (5-formamido-2,2,4,4-tetramethylpentyl)carbamothioic S-acid |
| SMILES | CC(C)(CNC=O)CC(C)(C)CNC(=O)S |
| InChI | InChI=1S/C11H22N2O2S/c1-10(2,6-12-8-14)5-11(3,4)7-13-9(15)16/h8H,5-7H2,1-4H3,(H,12,14)(H2,13,15,16) |
| InChIKey | FHWBFLQSFSJHFF-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|