C14H18N4S — CID 171500496
5-[(benzylamino)methyl]-N-methyl-2-methylsulfanylpyrimidin-4-amine (PubChem CID 171500496) has the molecular formula C14H18N4S and a molecular weight of 274.39 g/mol. Its IUPAC name is 5-[(benzylamino)methyl]-N-methyl-2-methylsulfanylpyrimidin-4-amine.
| Compound Name | 5-[(benzylamino)methyl]-N-methyl-2-methylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 171500496 |
| Molecular Formula | C14H18N4S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 5-[(benzylamino)methyl]-N-methyl-2-methylsulfanylpyrimidin-4-amine |
| SMILES | CNc1nc(SC)ncc1CNCc1ccccc1 |
| InChI | InChI=1S/C14H18N4S/c1-15-13-12(10-17-14(18-13)19-2)9-16-8-11-6-4-3-5-7-11/h3-7,10,16H,8-9H2,1-2H3,(H,15,17,18) |
| InChIKey | NDOKWSCFDOYHCE-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |