About 1-oxo-3,4-dihydro-2H-thieno[3,2-b]pyridine-7-thione
1-oxo-3,4-dihydro-2H-thieno[3,2-b]pyridine-7-thione (PubChem CID 171501237) has the molecular formula C7H7NOS2
and a molecular weight of 185.27 g/mol. Its IUPAC name is 1-oxo-3,4-dihydro-2H-thieno[3,2-b]pyridine-7-thione.
Molecular Properties
| Compound Name | 1-oxo-3,4-dihydro-2H-thieno[3,2-b]pyridine-7-thione |
| PubChem CID | 171501237 |
| Molecular Formula | C7H7NOS2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.00 |
| IUPAC Name | 1-oxo-3,4-dihydro-2H-thieno[3,2-b]pyridine-7-thione |
| SMILES | O=S1CCc2[nH]ccc(=S)c21 |
| InChI | InChI=1S/C7H7NOS2/c9-11-4-2-5-7(11)6(10)1-3-8-5/h1,3H,2,4H2,(H,8,10) |
| InChIKey | QNVLSBKBWVYMMU-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-oxo-3,4-dihydro-2H-thieno[3,2-b]pyridine-7-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxo-3,4-dihydro-2H-thieno[3,2-b]pyridine-7-thione?
The IUPAC name of 1-oxo-3,4-dihydro-2H-thieno[3,2-b]pyridine-7-thione (CID 171501237) is 1-oxo-3,4-dihydro-2H-thieno[3,2-b]pyridine-7-thione.
What is the SMILES notation for 1-oxo-3,4-dihydro-2H-thieno[3,2-b]pyridine-7-thione?
The canonical SMILES for 1-oxo-3,4-dihydro-2H-thieno[3,2-b]pyridine-7-thione is O=S1CCc2[nH]ccc(=S)c21.
What is the InChIKey of 1-oxo-3,4-dihydro-2H-thieno[3,2-b]pyridine-7-thione?
The InChIKey is QNVLSBKBWVYMMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NOS2/c9-11-4-2-5-7(11)6(10)1-3-8-5/h1,3H,2,4H2,(H,8,10).
What are the key properties of 1-oxo-3,4-dihydro-2H-thieno[3,2-b]pyridine-7-thione?
1-oxo-3,4-dihydro-2H-thieno[3,2-b]pyridine-7-thione has a molecular weight of 185.27 g/mol, XLogP of 1.41, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxo-3,4-dihydro-2H-thieno[3,2-b]pyridine-7-thione is sourced from PubChem (CID 171501237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).