C7H9NS — CID 142034850
2,3,4,7-tetrahydrothieno[3,2-b]pyridine (PubChem CID 142034850) has the molecular formula C7H9NS and a molecular weight of 139.22 g/mol. Its IUPAC name is 2,3,4,7-tetrahydrothieno[3,2-b]pyridine.
| Compound Name | 2,3,4,7-tetrahydrothieno[3,2-b]pyridine |
|---|---|
| PubChem CID | 142034850 |
| Molecular Formula | C7H9NS |
| Molecular Weight | 139.22 g/mol |
| Exact Mass | 139.05 |
| IUPAC Name | 2,3,4,7-tetrahydrothieno[3,2-b]pyridine |
| SMILES | C1=CNC2=C(C1)SCC2 |
| InChI | InChI=1S/C7H9NS/c1-2-7-6(8-4-1)3-5-9-7/h1,4,8H,2-3,5H2 |
| InChIKey | DGZNIYVPSIMSSH-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.22 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |