C7H11NS — CID 173176988
2-ethyl-3-methyl-4H-1,4-thiazine (PubChem CID 173176988) has the molecular formula C7H11NS and a molecular weight of 141.24 g/mol. Its IUPAC name is 2-ethyl-3-methyl-4H-1,4-thiazine.
| Compound Name | 2-ethyl-3-methyl-4H-1,4-thiazine |
|---|---|
| PubChem CID | 173176988 |
| Molecular Formula | C7H11NS |
| Molecular Weight | 141.24 g/mol |
| Exact Mass | 141.06 |
| IUPAC Name | 2-ethyl-3-methyl-4H-1,4-thiazine |
| SMILES | CCC1=C(C)NC=CS1 |
| InChI | InChI=1S/C7H11NS/c1-3-7-6(2)8-4-5-9-7/h4-5,8H,3H2,1-2H3 |
| InChIKey | RVZHLTWPRRCJEL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.24 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |