C15H11N4O3S- — CID 171501290
3-[[6-(1-cyanocyclopropyl)pyridine-3-carbonyl]amino]pyridine-2-sulfinate (PubChem CID 171501290) has the molecular formula C15H11N4O3S- and a molecular weight of 327.35 g/mol. Its IUPAC name is 3-[[6-(1-cyanocyclopropyl)pyridine-3-carbonyl]amino]pyridine-2-sulfinate.
| Compound Name | 3-[[6-(1-cyanocyclopropyl)pyridine-3-carbonyl]amino]pyridine-2-sulfinate |
|---|---|
| PubChem CID | 171501290 |
| Molecular Formula | C15H11N4O3S- |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | 3-[[6-(1-cyanocyclopropyl)pyridine-3-carbonyl]amino]pyridine-2-sulfinate |
| SMILES | N#CC1(c2ccc(C(=O)Nc3cccnc3S(=O)[O-])cn2)CC1 |
| InChI | InChI=1S/C15H12N4O3S/c16-9-15(5-6-15)12-4-3-10(8-18-12)13(20)19-11-2-1-7-17-14(11)23(21)22/h1-4,7-8H,5-6H2,(H,19,20)(H,21,22)/p-1 |
| InChIKey | LTFZDEBOGGRSNI-UHFFFAOYSA-M |
| XLogP | 1.52 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|