C12H8N4O3S — CID 171501249
3-[(6-cyanopyridine-3-carbonyl)amino]pyridine-2-sulfinic acid (PubChem CID 171501249) has the molecular formula C12H8N4O3S and a molecular weight of 288.29 g/mol. Its IUPAC name is 3-[(6-cyanopyridine-3-carbonyl)amino]pyridine-2-sulfinic acid.
| Compound Name | 3-[(6-cyanopyridine-3-carbonyl)amino]pyridine-2-sulfinic acid |
|---|---|
| PubChem CID | 171501249 |
| Molecular Formula | C12H8N4O3S |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 3-[(6-cyanopyridine-3-carbonyl)amino]pyridine-2-sulfinic acid |
| SMILES | N#Cc1ccc(C(=O)Nc2cccnc2S(=O)O)cn1 |
| InChI | InChI=1S/C12H8N4O3S/c13-6-9-4-3-8(7-15-9)11(17)16-10-2-1-5-14-12(10)20(18)19/h1-5,7H,(H,16,17)(H,18,19) |
| InChIKey | NPSGANHZXIPWOD-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|