C11H12F2OS — CID 171501387
4,4-difluoro-8-methyl-1-methylidene-2,3-dihydrothiochromene 1-oxide (PubChem CID 171501387) has the molecular formula C11H12F2OS and a molecular weight of 230.28 g/mol. Its IUPAC name is 4,4-difluoro-8-methyl-1-methylidene-2,3-dihydrothiochromene 1-oxide.
| Compound Name | 4,4-difluoro-8-methyl-1-methylidene-2,3-dihydrothiochromene 1-oxide |
|---|---|
| PubChem CID | 171501387 |
| Molecular Formula | C11H12F2OS |
| Molecular Weight | 230.28 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 4,4-difluoro-8-methyl-1-methylidene-2,3-dihydrothiochromene 1-oxide |
| SMILES | C=S1(=O)CCC(F)(F)c2cccc(C)c21 |
| InChI | InChI=1S/C11H12F2OS/c1-8-4-3-5-9-10(8)15(2,14)7-6-11(9,12)13/h3-5H,2,6-7H2,1H3 |
| InChIKey | RLSFZANPXWRCAS-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|