C20H19ClN2O3S — CID 171502111
N-[(2-chloroquinolin-7-yl)methyl]-N-(2-methyl-6-methylsulfonylphenyl)acetamide (PubChem CID 171502111) has the molecular formula C20H19ClN2O3S and a molecular weight of 402.90 g/mol. Its IUPAC name is N-[(2-chloroquinolin-7-yl)methyl]-N-(2-methyl-6-methylsulfonylphenyl)acetamide.
| Compound Name | N-[(2-chloroquinolin-7-yl)methyl]-N-(2-methyl-6-methylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 171502111 |
| Molecular Formula | C20H19ClN2O3S |
| Molecular Weight | 402.90 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | N-[(2-chloroquinolin-7-yl)methyl]-N-(2-methyl-6-methylsulfonylphenyl)acetamide |
| SMILES | CC(=O)N(Cc1ccc2ccc(Cl)nc2c1)c1c(C)cccc1S(C)(=O)=O |
| InChI | InChI=1S/C20H19ClN2O3S/c1-13-5-4-6-18(27(3,25)26)20(13)23(14(2)24)12-15-7-8-16-9-10-19(21)22-17(16)11-15/h4-11H,12H2,1-3H3 |
| InChIKey | NILHSZFNBCGLBJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.90 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|