C19H30IN5O3S — CID 171504442
tert-butyl N-(5-iodosulfanylpyrrolo[2,3-b]pyrazin-2-yl)-N-(2-oxoethyl)carbamate;ethane;pyrrolidine (PubChem CID 171504442) has the molecular formula C19H30IN5O3S and a molecular weight of 535.45 g/mol. Its IUPAC name is tert-butyl N-(5-iodosulfanylpyrrolo[2,3-b]pyrazin-2-yl)-N-(2-oxoethyl)carbamate;ethane;pyrrolidine.
| Compound Name | tert-butyl N-(5-iodosulfanylpyrrolo[2,3-b]pyrazin-2-yl)-N-(2-oxoethyl)carbamate;ethane;pyrrolidine |
|---|---|
| PubChem CID | 171504442 |
| Molecular Formula | C19H30IN5O3S |
| Molecular Weight | 535.45 g/mol |
| Exact Mass | 535.11 |
| IUPAC Name | tert-butyl N-(5-iodosulfanylpyrrolo[2,3-b]pyrazin-2-yl)-N-(2-oxoethyl)carbamate;ethane;pyrrolidine |
| SMILES | C1CCNC1.CC.CC(C)(C)OC(=O)N(CC=O)c1cnc2c(ccn2SI)n1 |
| InChI | InChI=1S/C13H15IN4O3S.C4H9N.C2H6/c1-13(2,3)21-12(20)17(6-7-19)10-8-15-11-9(16-10)4-5-18(11)22-14;1-2-4-5-3-1;1-2/h4-5,7-8H,6H2,1-3H3;5H,1-4H2;1-2H3 |
| InChIKey | XBRJKALDZXXZIS-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.45 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|