C23H31NO3 — CID 17150722
2-(2-butan-2-ylphenoxy)-N-(3-propoxyphenyl)butanamide (PubChem CID 17150722) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is 2-(2-butan-2-ylphenoxy)-N-(3-propoxyphenyl)butanamide.
| Compound Name | 2-(2-butan-2-ylphenoxy)-N-(3-propoxyphenyl)butanamide |
|---|---|
| PubChem CID | 17150722 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | 2-(2-butan-2-ylphenoxy)-N-(3-propoxyphenyl)butanamide |
| SMILES | CCCOc1cccc(NC(=O)C(CC)Oc2ccccc2C(C)CC)c1 |
| InChI | InChI=1S/C23H31NO3/c1-5-15-26-19-12-10-11-18(16-19)24-23(25)21(7-3)27-22-14-9-8-13-20(22)17(4)6-2/h8-14,16-17,21H,5-7,15H2,1-4H3,(H,24,25) |
| InChIKey | GSSYSSAZNWXPBP-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |