C27H36N2O3 — CID 17170670
3-[2-(2-butan-2-ylphenoxy)butanoylamino]-N-cyclohexylbenzamide (PubChem CID 17170670) has the molecular formula C27H36N2O3 and a molecular weight of 436.60 g/mol. Its IUPAC name is 3-[2-(2-butan-2-ylphenoxy)butanoylamino]-N-cyclohexylbenzamide.
| Compound Name | 3-[2-(2-butan-2-ylphenoxy)butanoylamino]-N-cyclohexylbenzamide |
|---|---|
| PubChem CID | 17170670 |
| Molecular Formula | C27H36N2O3 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.27 |
| IUPAC Name | 3-[2-(2-butan-2-ylphenoxy)butanoylamino]-N-cyclohexylbenzamide |
| SMILES | CCC(Oc1ccccc1C(C)CC)C(=O)Nc1cccc(C(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C27H36N2O3/c1-4-19(3)23-16-9-10-17-25(23)32-24(5-2)27(31)29-22-15-11-12-20(18-22)26(30)28-21-13-7-6-8-14-21/h9-12,15-19,21,24H,4-8,13-14H2,1-3H3,(H,28,30)(H,29,31) |
| InChIKey | WOIGPKPDQWZGOW-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |