C11H18ClNO6 — CID 171508478
4-[(3-acetyloxy-2-hydroxypropyl)-(2-chloroethyl)amino]-4-oxobutanoic acid (PubChem CID 171508478) has the molecular formula C11H18ClNO6 and a molecular weight of 295.72 g/mol. Its IUPAC name is 4-[(3-acetyloxy-2-hydroxypropyl)-(2-chloroethyl)amino]-4-oxobutanoic acid.
| Compound Name | 4-[(3-acetyloxy-2-hydroxypropyl)-(2-chloroethyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 171508478 |
| Molecular Formula | C11H18ClNO6 |
| Molecular Weight | 295.72 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 4-[(3-acetyloxy-2-hydroxypropyl)-(2-chloroethyl)amino]-4-oxobutanoic acid |
| SMILES | CC(=O)OCC(O)CN(CCCl)C(=O)CCC(=O)O |
| InChI | InChI=1S/C11H18ClNO6/c1-8(14)19-7-9(15)6-13(5-4-12)10(16)2-3-11(17)18/h9,15H,2-7H2,1H3,(H,17,18) |
| InChIKey | SXRJSNBDEUHDRA-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.72 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|