About N-ethyl-2,2-difluorospiro[2.3]hexan-5-amine;molecular hydrogen
N-ethyl-2,2-difluorospiro[2.3]hexan-5-amine;molecular hydrogen (PubChem CID 171510554) has the molecular formula C8H15F2N
and a molecular weight of 163.21 g/mol. Its IUPAC name is N-ethyl-2,2-difluorospiro[2.3]hexan-5-amine;molecular hydrogen.
Analyze N-ethyl-2,2-difluorospiro[2.3]hexan-5-amine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2,2-difluorospiro[2.3]hexan-5-amine;molecular hydrogen?
The IUPAC name of N-ethyl-2,2-difluorospiro[2.3]hexan-5-amine;molecular hydrogen (CID 171510554) is N-ethyl-2,2-difluorospiro[2.3]hexan-5-amine;molecular hydrogen.
What is the SMILES notation for N-ethyl-2,2-difluorospiro[2.3]hexan-5-amine;molecular hydrogen?
The canonical SMILES for N-ethyl-2,2-difluorospiro[2.3]hexan-5-amine;molecular hydrogen is CCNC1CC2(C1)CC2(F)F.[H][H].
What is the InChIKey of N-ethyl-2,2-difluorospiro[2.3]hexan-5-amine;molecular hydrogen?
The InChIKey is LETJVXWTRHVGRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F2N.H2/c1-2-11-6-3-7(4-6)5-8(7,9)10;/h6,11H,2-5H2,1H3;1H.
What are the key properties of N-ethyl-2,2-difluorospiro[2.3]hexan-5-amine;molecular hydrogen?
N-ethyl-2,2-difluorospiro[2.3]hexan-5-amine;molecular hydrogen has a molecular weight of 163.21 g/mol, XLogP of 2.03, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2,2-difluorospiro[2.3]hexan-5-amine;molecular hydrogen is sourced from PubChem (CID 171510554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).