C14H18BrN3O — CID 171511110
3-[1-[(3E)-5-bromohexa-1,3,5-trien-3-yl]-3-methoxycyclobutyl]-4-methyl-1,2,4-triazole (PubChem CID 171511110) has the molecular formula C14H18BrN3O and a molecular weight of 324.22 g/mol. Its IUPAC name is 3-[1-[(3E)-5-bromohexa-1,3,5-trien-3-yl]-3-methoxycyclobutyl]-4-methyl-1,2,4-triazole.
| Compound Name | 3-[1-[(3E)-5-bromohexa-1,3,5-trien-3-yl]-3-methoxycyclobutyl]-4-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 171511110 |
| Molecular Formula | C14H18BrN3O |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 3-[1-[(3E)-5-bromohexa-1,3,5-trien-3-yl]-3-methoxycyclobutyl]-4-methyl-1,2,4-triazole |
| SMILES | C=C/C(=C\C(=C)Br)C1(c2nncn2C)CC(OC)C1 |
| InChI | InChI=1S/C14H18BrN3O/c1-5-11(6-10(2)15)14(7-12(8-14)19-4)13-17-16-9-18(13)3/h5-6,9,12H,1-2,7-8H2,3-4H3/b11-6+ |
| InChIKey | GJSKBSJJPSVING-IZZDOVSWSA-N |
| XLogP | 2.88 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|