C13H17NO4 — CID 171511200
methyl (3E)-2-cyclobutyl-3-ethenyl-5-nitrohexa-3,5-dienoate (PubChem CID 171511200) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is methyl (3E)-2-cyclobutyl-3-ethenyl-5-nitrohexa-3,5-dienoate.
| Compound Name | methyl (3E)-2-cyclobutyl-3-ethenyl-5-nitrohexa-3,5-dienoate |
|---|---|
| PubChem CID | 171511200 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | methyl (3E)-2-cyclobutyl-3-ethenyl-5-nitrohexa-3,5-dienoate |
| SMILES | C=C/C(=C\C(=C)[N+](=O)[O-])C(C(=O)OC)C1CCC1 |
| InChI | InChI=1S/C13H17NO4/c1-4-10(8-9(2)14(16)17)12(13(15)18-3)11-6-5-7-11/h4,8,11-12H,1-2,5-7H2,3H3/b10-8+ |
| InChIKey | JRTLFEYMZZVSSE-CSKARUKUSA-N |
| XLogP | 2.48 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|