C26H28N4O2 — CID 171513370
5-[4-[4-[methyl-[(3-methylphenyl)methyl]amino]-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]pentanoic acid (PubChem CID 171513370) has the molecular formula C26H28N4O2 and a molecular weight of 428.54 g/mol. Its IUPAC name is 5-[4-[4-[methyl-[(3-methylphenyl)methyl]amino]-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]pentanoic acid.
| Compound Name | 5-[4-[4-[methyl-[(3-methylphenyl)methyl]amino]-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]pentanoic acid |
|---|---|
| PubChem CID | 171513370 |
| Molecular Formula | C26H28N4O2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 5-[4-[4-[methyl-[(3-methylphenyl)methyl]amino]-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]pentanoic acid |
| SMILES | Cc1cccc(CN(C)c2ncnc3[nH]c(-c4ccc(CCCCC(=O)O)cc4)cc23)c1 |
| InChI | InChI=1S/C26H28N4O2/c1-18-6-5-8-20(14-18)16-30(2)26-22-15-23(29-25(22)27-17-28-26)21-12-10-19(11-13-21)7-3-4-9-24(31)32/h5-6,8,10-15,17H,3-4,7,9,16H2,1-2H3,(H,31,32)(H,27,28,29) |
| InChIKey | JOKPFQGWKKRGJI-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|