About ethane;(1-propylpyrrolidin-3-yl) thiocyanate
ethane;(1-propylpyrrolidin-3-yl) thiocyanate (PubChem CID 171514937) has the molecular formula C10H20N2S
and a molecular weight of 200.35 g/mol. Its IUPAC name is ethane;(1-propylpyrrolidin-3-yl) thiocyanate.
Molecular Properties
| Compound Name | ethane;(1-propylpyrrolidin-3-yl) thiocyanate |
| PubChem CID | 171514937 |
| Molecular Formula | C10H20N2S |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | ethane;(1-propylpyrrolidin-3-yl) thiocyanate |
| SMILES | CC.CCCN1CCC(SC#N)C1 |
| InChI | InChI=1S/C8H14N2S.C2H6/c1-2-4-10-5-3-8(6-10)11-7-9;1-2/h8H,2-6H2,1H3;1-2H3 |
| InChIKey | RTRZTOIQKOYFTF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze ethane;(1-propylpyrrolidin-3-yl) thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(1-propylpyrrolidin-3-yl) thiocyanate?
The IUPAC name of ethane;(1-propylpyrrolidin-3-yl) thiocyanate (CID 171514937) is ethane;(1-propylpyrrolidin-3-yl) thiocyanate.
What is the SMILES notation for ethane;(1-propylpyrrolidin-3-yl) thiocyanate?
The canonical SMILES for ethane;(1-propylpyrrolidin-3-yl) thiocyanate is CC.CCCN1CCC(SC#N)C1.
What is the InChIKey of ethane;(1-propylpyrrolidin-3-yl) thiocyanate?
The InChIKey is RTRZTOIQKOYFTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2S.C2H6/c1-2-4-10-5-3-8(6-10)11-7-9;1-2/h8H,2-6H2,1H3;1-2H3.
What are the key properties of ethane;(1-propylpyrrolidin-3-yl) thiocyanate?
ethane;(1-propylpyrrolidin-3-yl) thiocyanate has a molecular weight of 200.35 g/mol, XLogP of 2.71, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(1-propylpyrrolidin-3-yl) thiocyanate is sourced from PubChem (CID 171514937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).