C14H17N3O — CID 171517883
N-[(6-amino-1H-indol-2-yl)methyl]-1-methylcyclopropane-1-carboxamide (PubChem CID 171517883) has the molecular formula C14H17N3O and a molecular weight of 243.31 g/mol. Its IUPAC name is N-[(6-amino-1H-indol-2-yl)methyl]-1-methylcyclopropane-1-carboxamide.
| Compound Name | N-[(6-amino-1H-indol-2-yl)methyl]-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 171517883 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | N-[(6-amino-1H-indol-2-yl)methyl]-1-methylcyclopropane-1-carboxamide |
| SMILES | CC1(C(=O)NCc2cc3ccc(N)cc3[nH]2)CC1 |
| InChI | InChI=1S/C14H17N3O/c1-14(4-5-14)13(18)16-8-11-6-9-2-3-10(15)7-12(9)17-11/h2-3,6-7,17H,4-5,8,15H2,1H3,(H,16,18) |
| InChIKey | KZLHDVJMFVLEKH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|