C18H25N5O2 — CID 171519353
N-[[6-(2,3-diiminopropoxy)-1H-indol-2-yl]methyl]-1-methylcyclopropane-1-carboxamide;methanamine (PubChem CID 171519353) has the molecular formula C18H25N5O2 and a molecular weight of 343.43 g/mol. Its IUPAC name is N-[[6-(2,3-diiminopropoxy)-1H-indol-2-yl]methyl]-1-methylcyclopropane-1-carboxamide;methanamine.
| Compound Name | N-[[6-(2,3-diiminopropoxy)-1H-indol-2-yl]methyl]-1-methylcyclopropane-1-carboxamide;methanamine |
|---|---|
| PubChem CID | 171519353 |
| Molecular Formula | C18H25N5O2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | N-[[6-(2,3-diiminopropoxy)-1H-indol-2-yl]methyl]-1-methylcyclopropane-1-carboxamide;methanamine |
| SMILES | CN.[H]/N=C/C(COc1ccc2cc(CNC(=O)C3(C)CC3)[nH]c2c1)=N\[H] |
| InChI | InChI=1S/C17H20N4O2.CH5N/c1-17(4-5-17)16(22)20-9-13-6-11-2-3-14(7-15(11)21-13)23-10-12(19)8-18;1-2/h2-3,6-8,18-19,21H,4-5,9-10H2,1H3,(H,20,22);2H2,1H3/b18-8+,19-12+; |
| InChIKey | GLQPSEXCNWKGRK-MVULTWQKSA-N |
| XLogP | 2.21 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|