About methanol;methyl 2-(chloromethyl)-6-methoxy-1-(4-methylphenyl)sulfanylindole-5-carboxylate
methanol;methyl 2-(chloromethyl)-6-methoxy-1-(4-methylphenyl)sulfanylindole-5-carboxylate (PubChem CID 171518413) has the molecular formula C20H22ClNO4S
and a molecular weight of 407.92 g/mol. Its IUPAC name is methanol;methyl 2-(chloromethyl)-6-methoxy-1-(4-methylphenyl)sulfanylindole-5-carboxylate.
Molecular Properties
| Compound Name | methanol;methyl 2-(chloromethyl)-6-methoxy-1-(4-methylphenyl)sulfanylindole-5-carboxylate |
| PubChem CID | 171518413 |
| Molecular Formula | C20H22ClNO4S |
| Molecular Weight | 407.92 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | methanol;methyl 2-(chloromethyl)-6-methoxy-1-(4-methylphenyl)sulfanylindole-5-carboxylate |
| SMILES | CO.COC(=O)c1cc2cc(CCl)n(Sc3ccc(C)cc3)c2cc1OC |
| InChI | InChI=1S/C19H18ClNO3S.CH4O/c1-12-4-6-15(7-5-12)25-21-14(11-20)8-13-9-16(19(22)24-3)18(23-2)10-17(13)21;1-2/h4-10H,11H2,1-3H3;2H,1H3 |
| InChIKey | VQJOKCKOLGUUNL-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.92 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze methanol;methyl 2-(chloromethyl)-6-methoxy-1-(4-methylphenyl)sulfanylindole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;methyl 2-(chloromethyl)-6-methoxy-1-(4-methylphenyl)sulfanylindole-5-carboxylate?
The IUPAC name of methanol;methyl 2-(chloromethyl)-6-methoxy-1-(4-methylphenyl)sulfanylindole-5-carboxylate (CID 171518413) is methanol;methyl 2-(chloromethyl)-6-methoxy-1-(4-methylphenyl)sulfanylindole-5-carboxylate.
What is the SMILES notation for methanol;methyl 2-(chloromethyl)-6-methoxy-1-(4-methylphenyl)sulfanylindole-5-carboxylate?
The canonical SMILES for methanol;methyl 2-(chloromethyl)-6-methoxy-1-(4-methylphenyl)sulfanylindole-5-carboxylate is CO.COC(=O)c1cc2cc(CCl)n(Sc3ccc(C)cc3)c2cc1OC.
What is the InChIKey of methanol;methyl 2-(chloromethyl)-6-methoxy-1-(4-methylphenyl)sulfanylindole-5-carboxylate?
The InChIKey is VQJOKCKOLGUUNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18ClNO3S.CH4O/c1-12-4-6-15(7-5-12)25-21-14(11-20)8-13-9-16(19(22)24-3)18(23-2)10-17(13)21;1-2/h4-10H,11H2,1-3H3;2H,1H3.
What are the key properties of methanol;methyl 2-(chloromethyl)-6-methoxy-1-(4-methylphenyl)sulfanylindole-5-carboxylate?
methanol;methyl 2-(chloromethyl)-6-methoxy-1-(4-methylphenyl)sulfanylindole-5-carboxylate has a molecular weight of 407.92 g/mol, XLogP of 4.65, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;methyl 2-(chloromethyl)-6-methoxy-1-(4-methylphenyl)sulfanylindole-5-carboxylate is sourced from PubChem (CID 171518413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).