C22H25BrN2O5S — CID 171518563
tert-butyl N-[[6-bromo-5-methoxy-1-(4-methylphenyl)sulfonylindol-2-yl]methyl]carbamate (PubChem CID 171518563) has the molecular formula C22H25BrN2O5S and a molecular weight of 509.42 g/mol. Its IUPAC name is tert-butyl N-[[6-bromo-5-methoxy-1-(4-methylphenyl)sulfonylindol-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[6-bromo-5-methoxy-1-(4-methylphenyl)sulfonylindol-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 171518563 |
| Molecular Formula | C22H25BrN2O5S |
| Molecular Weight | 509.42 g/mol |
| Exact Mass | 508.07 |
| IUPAC Name | tert-butyl N-[[6-bromo-5-methoxy-1-(4-methylphenyl)sulfonylindol-2-yl]methyl]carbamate |
| SMILES | COc1cc2cc(CNC(=O)OC(C)(C)C)n(S(=O)(=O)c3ccc(C)cc3)c2cc1Br |
| InChI | InChI=1S/C22H25BrN2O5S/c1-14-6-8-17(9-7-14)31(27,28)25-16(13-24-21(26)30-22(2,3)4)10-15-11-20(29-5)18(23)12-19(15)25/h6-12H,13H2,1-5H3,(H,24,26) |
| InChIKey | BIADOIQXHMYZIU-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.42 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |