About [5-fluoro-6-[(5-methyl-1,2-oxazol-3-yl)methoxy]-1H-indol-2-yl]methanamine
[5-fluoro-6-[(5-methyl-1,2-oxazol-3-yl)methoxy]-1H-indol-2-yl]methanamine (PubChem CID 171519239) has the molecular formula C14H14FN3O2
and a molecular weight of 275.28 g/mol. Its IUPAC name is [5-fluoro-6-[(5-methyl-1,2-oxazol-3-yl)methoxy]-1H-indol-2-yl]methanamine.
Molecular Properties
| Compound Name | [5-fluoro-6-[(5-methyl-1,2-oxazol-3-yl)methoxy]-1H-indol-2-yl]methanamine |
| PubChem CID | 171519239 |
| Molecular Formula | C14H14FN3O2 |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | [5-fluoro-6-[(5-methyl-1,2-oxazol-3-yl)methoxy]-1H-indol-2-yl]methanamine |
| SMILES | Cc1cc(COc2cc3[nH]c(CN)cc3cc2F)no1 |
| InChI | InChI=1S/C14H14FN3O2/c1-8-2-11(18-20-8)7-19-14-5-13-9(4-12(14)15)3-10(6-16)17-13/h2-5,17H,6-7,16H2,1H3 |
| InChIKey | UABFZSXXAPHBSR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-fluoro-6-[(5-methyl-1,2-oxazol-3-yl)methoxy]-1H-indol-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-fluoro-6-[(5-methyl-1,2-oxazol-3-yl)methoxy]-1H-indol-2-yl]methanamine?
The IUPAC name of [5-fluoro-6-[(5-methyl-1,2-oxazol-3-yl)methoxy]-1H-indol-2-yl]methanamine (CID 171519239) is [5-fluoro-6-[(5-methyl-1,2-oxazol-3-yl)methoxy]-1H-indol-2-yl]methanamine.
What is the SMILES notation for [5-fluoro-6-[(5-methyl-1,2-oxazol-3-yl)methoxy]-1H-indol-2-yl]methanamine?
The canonical SMILES for [5-fluoro-6-[(5-methyl-1,2-oxazol-3-yl)methoxy]-1H-indol-2-yl]methanamine is Cc1cc(COc2cc3[nH]c(CN)cc3cc2F)no1.
What is the InChIKey of [5-fluoro-6-[(5-methyl-1,2-oxazol-3-yl)methoxy]-1H-indol-2-yl]methanamine?
The InChIKey is UABFZSXXAPHBSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14FN3O2/c1-8-2-11(18-20-8)7-19-14-5-13-9(4-12(14)15)3-10(6-16)17-13/h2-5,17H,6-7,16H2,1H3.
What are the key properties of [5-fluoro-6-[(5-methyl-1,2-oxazol-3-yl)methoxy]-1H-indol-2-yl]methanamine?
[5-fluoro-6-[(5-methyl-1,2-oxazol-3-yl)methoxy]-1H-indol-2-yl]methanamine has a molecular weight of 275.28 g/mol, XLogP of 2.64, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-fluoro-6-[(5-methyl-1,2-oxazol-3-yl)methoxy]-1H-indol-2-yl]methanamine is sourced from PubChem (CID 171519239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).