About N-[[5-fluoro-6-(1,3-oxazol-4-ylmethoxy)-1H-indol-2-yl]methyl]-2-methylpropanamide
N-[[5-fluoro-6-(1,3-oxazol-4-ylmethoxy)-1H-indol-2-yl]methyl]-2-methylpropanamide (PubChem CID 171518318) has the molecular formula C17H18FN3O3
and a molecular weight of 331.35 g/mol. Its IUPAC name is N-[[5-fluoro-6-(1,3-oxazol-4-ylmethoxy)-1H-indol-2-yl]methyl]-2-methylpropanamide.
Molecular Properties
| Compound Name | N-[[5-fluoro-6-(1,3-oxazol-4-ylmethoxy)-1H-indol-2-yl]methyl]-2-methylpropanamide |
| PubChem CID | 171518318 |
| Molecular Formula | C17H18FN3O3 |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | N-[[5-fluoro-6-(1,3-oxazol-4-ylmethoxy)-1H-indol-2-yl]methyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NCc1cc2cc(F)c(OCc3cocn3)cc2[nH]1 |
| InChI | InChI=1S/C17H18FN3O3/c1-10(2)17(22)19-6-12-3-11-4-14(18)16(5-15(11)21-12)24-8-13-7-23-9-20-13/h3-5,7,9-10,21H,6,8H2,1-2H3,(H,19,22) |
| InChIKey | PKYJHFFNPHOLDC-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[5-fluoro-6-(1,3-oxazol-4-ylmethoxy)-1H-indol-2-yl]methyl]-2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[5-fluoro-6-(1,3-oxazol-4-ylmethoxy)-1H-indol-2-yl]methyl]-2-methylpropanamide?
The IUPAC name of N-[[5-fluoro-6-(1,3-oxazol-4-ylmethoxy)-1H-indol-2-yl]methyl]-2-methylpropanamide (CID 171518318) is N-[[5-fluoro-6-(1,3-oxazol-4-ylmethoxy)-1H-indol-2-yl]methyl]-2-methylpropanamide.
What is the SMILES notation for N-[[5-fluoro-6-(1,3-oxazol-4-ylmethoxy)-1H-indol-2-yl]methyl]-2-methylpropanamide?
The canonical SMILES for N-[[5-fluoro-6-(1,3-oxazol-4-ylmethoxy)-1H-indol-2-yl]methyl]-2-methylpropanamide is CC(C)C(=O)NCc1cc2cc(F)c(OCc3cocn3)cc2[nH]1.
What is the InChIKey of N-[[5-fluoro-6-(1,3-oxazol-4-ylmethoxy)-1H-indol-2-yl]methyl]-2-methylpropanamide?
The InChIKey is PKYJHFFNPHOLDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18FN3O3/c1-10(2)17(22)19-6-12-3-11-4-14(18)16(5-15(11)21-12)24-8-13-7-23-9-20-13/h3-5,7,9-10,21H,6,8H2,1-2H3,(H,19,22).
What are the key properties of N-[[5-fluoro-6-(1,3-oxazol-4-ylmethoxy)-1H-indol-2-yl]methyl]-2-methylpropanamide?
N-[[5-fluoro-6-(1,3-oxazol-4-ylmethoxy)-1H-indol-2-yl]methyl]-2-methylpropanamide has a molecular weight of 331.35 g/mol, XLogP of 3.15, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[5-fluoro-6-(1,3-oxazol-4-ylmethoxy)-1H-indol-2-yl]methyl]-2-methylpropanamide is sourced from PubChem (CID 171518318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).