About N-[[5-fluoro-6-(1,2-oxazol-3-ylmethoxy)-1H-indol-2-yl]methyl]pyrrolidine-1-carboxamide
N-[[5-fluoro-6-(1,2-oxazol-3-ylmethoxy)-1H-indol-2-yl]methyl]pyrrolidine-1-carboxamide (PubChem CID 171519810) has the molecular formula C18H19FN4O3
and a molecular weight of 358.37 g/mol. Its IUPAC name is N-[[5-fluoro-6-(1,2-oxazol-3-ylmethoxy)-1H-indol-2-yl]methyl]pyrrolidine-1-carboxamide.
Molecular Properties
| Compound Name | N-[[5-fluoro-6-(1,2-oxazol-3-ylmethoxy)-1H-indol-2-yl]methyl]pyrrolidine-1-carboxamide |
| PubChem CID | 171519810 |
| Molecular Formula | C18H19FN4O3 |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | N-[[5-fluoro-6-(1,2-oxazol-3-ylmethoxy)-1H-indol-2-yl]methyl]pyrrolidine-1-carboxamide |
| SMILES | O=C(NCc1cc2cc(F)c(OCc3ccon3)cc2[nH]1)N1CCCC1 |
| InChI | InChI=1S/C18H19FN4O3/c19-15-8-12-7-14(10-20-18(24)23-4-1-2-5-23)21-16(12)9-17(15)25-11-13-3-6-26-22-13/h3,6-9,21H,1-2,4-5,10-11H2,(H,20,24) |
| InChIKey | YLZTXPRBESVERU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[5-fluoro-6-(1,2-oxazol-3-ylmethoxy)-1H-indol-2-yl]methyl]pyrrolidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[5-fluoro-6-(1,2-oxazol-3-ylmethoxy)-1H-indol-2-yl]methyl]pyrrolidine-1-carboxamide?
The IUPAC name of N-[[5-fluoro-6-(1,2-oxazol-3-ylmethoxy)-1H-indol-2-yl]methyl]pyrrolidine-1-carboxamide (CID 171519810) is N-[[5-fluoro-6-(1,2-oxazol-3-ylmethoxy)-1H-indol-2-yl]methyl]pyrrolidine-1-carboxamide.
What is the SMILES notation for N-[[5-fluoro-6-(1,2-oxazol-3-ylmethoxy)-1H-indol-2-yl]methyl]pyrrolidine-1-carboxamide?
The canonical SMILES for N-[[5-fluoro-6-(1,2-oxazol-3-ylmethoxy)-1H-indol-2-yl]methyl]pyrrolidine-1-carboxamide is O=C(NCc1cc2cc(F)c(OCc3ccon3)cc2[nH]1)N1CCCC1.
What is the InChIKey of N-[[5-fluoro-6-(1,2-oxazol-3-ylmethoxy)-1H-indol-2-yl]methyl]pyrrolidine-1-carboxamide?
The InChIKey is YLZTXPRBESVERU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19FN4O3/c19-15-8-12-7-14(10-20-18(24)23-4-1-2-5-23)21-16(12)9-17(15)25-11-13-3-6-26-22-13/h3,6-9,21H,1-2,4-5,10-11H2,(H,20,24).
What are the key properties of N-[[5-fluoro-6-(1,2-oxazol-3-ylmethoxy)-1H-indol-2-yl]methyl]pyrrolidine-1-carboxamide?
N-[[5-fluoro-6-(1,2-oxazol-3-ylmethoxy)-1H-indol-2-yl]methyl]pyrrolidine-1-carboxamide has a molecular weight of 358.37 g/mol, XLogP of 3.18, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[5-fluoro-6-(1,2-oxazol-3-ylmethoxy)-1H-indol-2-yl]methyl]pyrrolidine-1-carboxamide is sourced from PubChem (CID 171519810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).