C21H16N6O — CID 171521019
N-[4-[3-cyano-7-(1-methylpyrazol-4-yl)imidazo[1,2-a]pyridin-5-yl]phenyl]prop-2-enamide (PubChem CID 171521019) has the molecular formula C21H16N6O and a molecular weight of 368.40 g/mol. Its IUPAC name is N-[4-[3-cyano-7-(1-methylpyrazol-4-yl)imidazo[1,2-a]pyridin-5-yl]phenyl]prop-2-enamide.
| Compound Name | N-[4-[3-cyano-7-(1-methylpyrazol-4-yl)imidazo[1,2-a]pyridin-5-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 171521019 |
| Molecular Formula | C21H16N6O |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | N-[4-[3-cyano-7-(1-methylpyrazol-4-yl)imidazo[1,2-a]pyridin-5-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(-c2cc(-c3cnn(C)c3)cc3ncc(C#N)n23)cc1 |
| InChI | InChI=1S/C21H16N6O/c1-3-21(28)25-17-6-4-14(5-7-17)19-8-15(16-11-24-26(2)13-16)9-20-23-12-18(10-22)27(19)20/h3-9,11-13H,1H2,2H3,(H,25,28) |
| InChIKey | NIHWQLXNAJPAEM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 88.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|