C18H14N4O — CID 169260618
N-[3-(4-cyanophenyl)-1-methylpyrrolo[2,3-b]pyridin-5-yl]prop-2-enamide (PubChem CID 169260618) has the molecular formula C18H14N4O and a molecular weight of 302.34 g/mol. Its IUPAC name is N-[3-(4-cyanophenyl)-1-methylpyrrolo[2,3-b]pyridin-5-yl]prop-2-enamide.
| Compound Name | N-[3-(4-cyanophenyl)-1-methylpyrrolo[2,3-b]pyridin-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 169260618 |
| Molecular Formula | C18H14N4O |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | N-[3-(4-cyanophenyl)-1-methylpyrrolo[2,3-b]pyridin-5-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cnc2c(c1)c(-c1ccc(C#N)cc1)cn2C |
| InChI | InChI=1S/C18H14N4O/c1-3-17(23)21-14-8-15-16(11-22(2)18(15)20-10-14)13-6-4-12(9-19)5-7-13/h3-8,10-11H,1H2,2H3,(H,21,23) |
| InChIKey | OEHMBILLVFGGLO-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|