C14H21NO2 — CID 171523267
ethane;4-ethyl-7-methyl-2,3-dihydro-1,4-benzoxazepin-5-one (PubChem CID 171523267) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is ethane;4-ethyl-7-methyl-2,3-dihydro-1,4-benzoxazepin-5-one.
| Compound Name | ethane;4-ethyl-7-methyl-2,3-dihydro-1,4-benzoxazepin-5-one |
|---|---|
| PubChem CID | 171523267 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | ethane;4-ethyl-7-methyl-2,3-dihydro-1,4-benzoxazepin-5-one |
| SMILES | CC.CCN1CCOc2ccc(C)cc2C1=O |
| InChI | InChI=1S/C12H15NO2.C2H6/c1-3-13-6-7-15-11-5-4-9(2)8-10(11)12(13)14;1-2/h4-5,8H,3,6-7H2,1-2H3;1-2H3 |
| InChIKey | UFWFARSJKVMVDN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |