C12H23N3 — CID 171523504
ethane;(3Z)-1-ethyl-3-(2-iminopropylidene)piperidin-4-imine (PubChem CID 171523504) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is ethane;(3Z)-1-ethyl-3-(2-iminopropylidene)piperidin-4-imine.
| Compound Name | ethane;(3Z)-1-ethyl-3-(2-iminopropylidene)piperidin-4-imine |
|---|---|
| PubChem CID | 171523504 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | ethane;(3Z)-1-ethyl-3-(2-iminopropylidene)piperidin-4-imine |
| SMILES | CC.[H]/N=C(C)/C=C1/CN(CC)CC/C1=N\[H] |
| InChI | InChI=1S/C10H17N3.C2H6/c1-3-13-5-4-10(12)9(7-13)6-8(2)11;1-2/h6,11-12H,3-5,7H2,1-2H3;1-2H3/b9-6-,11-8+,12-10+; |
| InChIKey | UWZPZFLZKYKUQC-MNJLTXIASA-N |
| XLogP | 2.72 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|