C10H17N3 — CID 171523505
(3Z)-1-ethyl-3-(2-iminopropylidene)piperidin-4-imine (PubChem CID 171523505) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is (3Z)-1-ethyl-3-(2-iminopropylidene)piperidin-4-imine.
| Compound Name | (3Z)-1-ethyl-3-(2-iminopropylidene)piperidin-4-imine |
|---|---|
| PubChem CID | 171523505 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | (3Z)-1-ethyl-3-(2-iminopropylidene)piperidin-4-imine |
| SMILES | [H]/N=C(C)/C=C1/CN(CC)CC/C1=N\[H] |
| InChI | InChI=1S/C10H17N3/c1-3-13-5-4-10(12)9(7-13)6-8(2)11/h6,11-12H,3-5,7H2,1-2H3/b9-6-,11-8+,12-10+ |
| InChIKey | RAWOGHOTYHFOKS-CLPUCUGASA-N |
| XLogP | 1.70 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|