C26H34F2N2O2Si — CID 171523836
4-[tert-butyl(diphenyl)silyl]oxy-1-[(3R)-5,5-difluoropiperidin-3-yl]piperidin-2-one (PubChem CID 171523836) has the molecular formula C26H34F2N2O2Si and a molecular weight of 472.65 g/mol. Its IUPAC name is 4-[tert-butyl(diphenyl)silyl]oxy-1-[(3R)-5,5-difluoropiperidin-3-yl]piperidin-2-one.
| Compound Name | 4-[tert-butyl(diphenyl)silyl]oxy-1-[(3R)-5,5-difluoropiperidin-3-yl]piperidin-2-one |
|---|---|
| PubChem CID | 171523836 |
| Molecular Formula | C26H34F2N2O2Si |
| Molecular Weight | 472.65 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | 4-[tert-butyl(diphenyl)silyl]oxy-1-[(3R)-5,5-difluoropiperidin-3-yl]piperidin-2-one |
| SMILES | CC(C)(C)[Si](OC1CCN([C@H]2CNCC(F)(F)C2)C(=O)C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H34F2N2O2Si/c1-25(2,3)33(22-10-6-4-7-11-22,23-12-8-5-9-13-23)32-21-14-15-30(24(31)16-21)20-17-26(27,28)19-29-18-20/h4-13,20-21,29H,14-19H2,1-3H3/t20-,21?/m1/s1 |
| InChIKey | LZRQDUJUFGSVGX-VQCQRNETSA-N |
| XLogP | 3.55 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.65 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|