About 2-[4-[(1S)-5-bromo-2,3-dihydro-1H-inden-1-yl]piperazin-1-yl]propane-1,3-diol
2-[4-[(1S)-5-bromo-2,3-dihydro-1H-inden-1-yl]piperazin-1-yl]propane-1,3-diol (PubChem CID 171524846) has the molecular formula C16H23BrN2O2
and a molecular weight of 355.28 g/mol. Its IUPAC name is 2-[4-[(1S)-5-bromo-2,3-dihydro-1H-inden-1-yl]piperazin-1-yl]propane-1,3-diol.
Molecular Properties
| Compound Name | 2-[4-[(1S)-5-bromo-2,3-dihydro-1H-inden-1-yl]piperazin-1-yl]propane-1,3-diol |
| PubChem CID | 171524846 |
| Molecular Formula | C16H23BrN2O2 |
| Molecular Weight | 355.28 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 2-[4-[(1S)-5-bromo-2,3-dihydro-1H-inden-1-yl]piperazin-1-yl]propane-1,3-diol |
| SMILES | OCC(CO)N1CCN([C@H]2CCc3cc(Br)ccc32)CC1 |
| InChI | InChI=1S/C16H23BrN2O2/c17-13-2-3-15-12(9-13)1-4-16(15)19-7-5-18(6-8-19)14(10-20)11-21/h2-3,9,14,16,20-21H,1,4-8,10-11H2/t16-/m0/s1 |
| InChIKey | BRAJMPITTOLSSZ-INIZCTEOSA-N |
| XLogP | 1.41 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.28 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-[(1S)-5-bromo-2,3-dihydro-1H-inden-1-yl]piperazin-1-yl]propane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(1S)-5-bromo-2,3-dihydro-1H-inden-1-yl]piperazin-1-yl]propane-1,3-diol?
The IUPAC name of 2-[4-[(1S)-5-bromo-2,3-dihydro-1H-inden-1-yl]piperazin-1-yl]propane-1,3-diol (CID 171524846) is 2-[4-[(1S)-5-bromo-2,3-dihydro-1H-inden-1-yl]piperazin-1-yl]propane-1,3-diol.
What is the SMILES notation for 2-[4-[(1S)-5-bromo-2,3-dihydro-1H-inden-1-yl]piperazin-1-yl]propane-1,3-diol?
The canonical SMILES for 2-[4-[(1S)-5-bromo-2,3-dihydro-1H-inden-1-yl]piperazin-1-yl]propane-1,3-diol is OCC(CO)N1CCN([C@H]2CCc3cc(Br)ccc32)CC1.
What is the InChIKey of 2-[4-[(1S)-5-bromo-2,3-dihydro-1H-inden-1-yl]piperazin-1-yl]propane-1,3-diol?
The InChIKey is BRAJMPITTOLSSZ-INIZCTEOSA-N. The full InChI is InChI=1S/C16H23BrN2O2/c17-13-2-3-15-12(9-13)1-4-16(15)19-7-5-18(6-8-19)14(10-20)11-21/h2-3,9,14,16,20-21H,1,4-8,10-11H2/t16-/m0/s1.
What are the key properties of 2-[4-[(1S)-5-bromo-2,3-dihydro-1H-inden-1-yl]piperazin-1-yl]propane-1,3-diol?
2-[4-[(1S)-5-bromo-2,3-dihydro-1H-inden-1-yl]piperazin-1-yl]propane-1,3-diol has a molecular weight of 355.28 g/mol, XLogP of 1.41, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(1S)-5-bromo-2,3-dihydro-1H-inden-1-yl]piperazin-1-yl]propane-1,3-diol is sourced from PubChem (CID 171524846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).