C13H24BrFN2O — CID 171525908
N-[2-(1-bromo-4-fluoro-4,5-dimethylpiperidin-3-yl)-2-methylpropyl]-N-methylformamide (PubChem CID 171525908) has the molecular formula C13H24BrFN2O and a molecular weight of 323.25 g/mol. Its IUPAC name is N-[2-(1-bromo-4-fluoro-4,5-dimethylpiperidin-3-yl)-2-methylpropyl]-N-methylformamide.
| Compound Name | N-[2-(1-bromo-4-fluoro-4,5-dimethylpiperidin-3-yl)-2-methylpropyl]-N-methylformamide |
|---|---|
| PubChem CID | 171525908 |
| Molecular Formula | C13H24BrFN2O |
| Molecular Weight | 323.25 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | N-[2-(1-bromo-4-fluoro-4,5-dimethylpiperidin-3-yl)-2-methylpropyl]-N-methylformamide |
| SMILES | CC1CN(Br)CC(C(C)(C)CN(C)C=O)C1(C)F |
| InChI | InChI=1S/C13H24BrFN2O/c1-10-6-17(14)7-11(13(10,4)15)12(2,3)8-16(5)9-18/h9-11H,6-8H2,1-5H3 |
| InChIKey | AYTNJAUHVWTUMQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.25 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|