C9H8F3N5 — CID 171530536
5-[1-methyl-4-(trifluoromethyl)imidazol-2-yl]pyrimidin-2-amine (PubChem CID 171530536) has the molecular formula C9H8F3N5 and a molecular weight of 243.19 g/mol. Its IUPAC name is 5-[1-methyl-4-(trifluoromethyl)imidazol-2-yl]pyrimidin-2-amine.
| Compound Name | 5-[1-methyl-4-(trifluoromethyl)imidazol-2-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 171530536 |
| Molecular Formula | C9H8F3N5 |
| Molecular Weight | 243.19 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 5-[1-methyl-4-(trifluoromethyl)imidazol-2-yl]pyrimidin-2-amine |
| SMILES | Cn1cc(C(F)(F)F)nc1-c1cnc(N)nc1 |
| InChI | InChI=1S/C9H8F3N5/c1-17-4-6(9(10,11)12)16-7(17)5-2-14-8(13)15-3-5/h2-4H,1H3,(H2,13,14,15) |
| InChIKey | DKLOUVHLLFUPKQ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.19 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |