C18H21ClN4O — CID 17153115
1-(3-chlorophenyl)-N,N-bis(2-cyanoethyl)piperidine-4-carboxamide (PubChem CID 17153115) has the molecular formula C18H21ClN4O and a molecular weight of 344.85 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N,N-bis(2-cyanoethyl)piperidine-4-carboxamide.
| Compound Name | 1-(3-chlorophenyl)-N,N-bis(2-cyanoethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 17153115 |
| Molecular Formula | C18H21ClN4O |
| Molecular Weight | 344.85 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 1-(3-chlorophenyl)-N,N-bis(2-cyanoethyl)piperidine-4-carboxamide |
| SMILES | N#CCCN(CCC#N)C(=O)C1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C18H21ClN4O/c19-16-4-1-5-17(14-16)22-12-6-15(7-13-22)18(24)23(10-2-8-20)11-3-9-21/h1,4-5,14-15H,2-3,6-7,10-13H2 |
| InChIKey | JNYNOGJBPBMFHH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 71.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.85 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |