C9H20N2 — CID 171531463
acetylene;N,N-dimethyl-1-[(2R)-pyrrolidin-2-yl]methanamine;molecular hydrogen (PubChem CID 171531463) has the molecular formula C9H20N2 and a molecular weight of 156.27 g/mol. Its IUPAC name is acetylene;N,N-dimethyl-1-[(2R)-pyrrolidin-2-yl]methanamine;molecular hydrogen.
| Compound Name | acetylene;N,N-dimethyl-1-[(2R)-pyrrolidin-2-yl]methanamine;molecular hydrogen |
|---|---|
| PubChem CID | 171531463 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | acetylene;N,N-dimethyl-1-[(2R)-pyrrolidin-2-yl]methanamine;molecular hydrogen |
| SMILES | C#C.CN(C)C[C@H]1CCCN1.[H][H] |
| InChI | InChI=1S/C7H16N2.C2H2.H2/c1-9(2)6-7-4-3-5-8-7;1-2;/h7-8H,3-6H2,1-2H3;1-2H;1H/t7-;;/m1../s1 |
| InChIKey | OGWCXOBBODFBPO-XCUBXKJBSA-N |
| XLogP | 0.80 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|