About 1-[(2S)-azetidin-2-yl]-N,N-dimethylmethanamine;ethane
1-[(2S)-azetidin-2-yl]-N,N-dimethylmethanamine;ethane (PubChem CID 156727541) has the molecular formula C8H20N2
and a molecular weight of 144.26 g/mol. Its IUPAC name is 1-[(2S)-azetidin-2-yl]-N,N-dimethylmethanamine;ethane.
Analyze 1-[(2S)-azetidin-2-yl]-N,N-dimethylmethanamine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2S)-azetidin-2-yl]-N,N-dimethylmethanamine;ethane?
The IUPAC name of 1-[(2S)-azetidin-2-yl]-N,N-dimethylmethanamine;ethane (CID 156727541) is 1-[(2S)-azetidin-2-yl]-N,N-dimethylmethanamine;ethane.
What is the SMILES notation for 1-[(2S)-azetidin-2-yl]-N,N-dimethylmethanamine;ethane?
The canonical SMILES for 1-[(2S)-azetidin-2-yl]-N,N-dimethylmethanamine;ethane is CC.CN(C)C[C@@H]1CCN1.
What is the InChIKey of 1-[(2S)-azetidin-2-yl]-N,N-dimethylmethanamine;ethane?
The InChIKey is IZDDQUSUFDKSHT-RGMNGODLSA-N. The full InChI is InChI=1S/C6H14N2.C2H6/c1-8(2)5-6-3-4-7-6;1-2/h6-7H,3-5H2,1-2H3;1-2H3/t6-;/m0./s1.
What are the key properties of 1-[(2S)-azetidin-2-yl]-N,N-dimethylmethanamine;ethane?
1-[(2S)-azetidin-2-yl]-N,N-dimethylmethanamine;ethane has a molecular weight of 144.26 g/mol, XLogP of 0.94, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2S)-azetidin-2-yl]-N,N-dimethylmethanamine;ethane is sourced from PubChem (CID 156727541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).